N-(Benzyloxycarbonyl)-D-proline, commonly referred to as Cbz-D-Pro-OH, is a protected amino acid derivative used as a reagent in peptide synthesis. Its significance lies in its role as a protecting group reagent, where the benzyloxycarbonyl (Cbz) group temporarily shields the amino function during peptide chain assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6404-31-5
1-Carbobenzoxy-2-piperidinecarboxylic Acid
pharmaceutical intermediate for peptide synthesis
(S)-1-N-Cbz-Pipecolinic acid
Pharmaceutical intermediate for peptide synthesis
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
Peptide research compound
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
N-Benzyloxycarbonyl-L-leucine
Peptide synthesis protecting group reagent
3-Hydroxypiperidine hydrochloride
Pharmaceutical intermediate for drug synthesis
(3aR,4R,5R,6aS)-5-((tert-Butyldimethylsilyl)oxy)-4-((E)-3-oxooct-1-en-1-yl)hexahydro-2H-cyclopenta[b]furan-2-one
Pharmaceutical intermediate for prostaglandin synthesis
(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
JXGVXCZADZNAMJ-LLVKDONJSA-N
C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O