N-Benzyloxycarbonyl-L-leucine is a chemical compound used as a protecting group reagent in peptide synthesis. It is also the substrate for the enzyme Nα-benzyloxycarbonylleucine hydrolase, which catalyzes its hydrolysis to benzyl alcohol, carbon dioxide, and L-leucine.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2018-66-8
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
6-BROMO-1-BENZOFURAN-3(2H)-ONE
Pharmaceutical intermediate
(3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one
synthetic intermediate for beta-lactam antibiotics
(2R,3R)-N-((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)-3-Methoxy-2-Methyl-3-((S)-pyrrolidin-2-yl)propanaMide (hydrochloride)
peptide intermediate for pharmaceutical research
2-(3-chloro-5-fluorophenyl)acetic acid
Pharmaceutical intermediate for drug synthesis
(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid
USPFMEKVPDBMCG-LBPRGKRZSA-N
CC(C)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1