2-Bromoclobetasone butyrate is a brominated derivative of clobetasone butyrate, a synthetic corticosteroid. It is primarily used as an intermediate in the pharmaceutical manufacturing process.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 639817-51-9
Clobetasone butyrate
topical corticosteroid anti-inflammatory agent
Ethyl 2-sulfanyl-1H-imidazole-4-carboxylate
Pharmaceutical intermediate
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
3-Hydroxypiperidine hydrochloride
Pharmaceutical intermediate for drug synthesis
(3aR,4R,5R,6aS)-5-((tert-Butyldimethylsilyl)oxy)-4-((E)-3-oxooct-1-en-1-yl)hexahydro-2H-cyclopenta[b]furan-2-one
Pharmaceutical intermediate for prostaglandin synthesis
[(8S,9R,10S,13S,14S,16S,17R)-2-bromo-17-(2-chloroacetyl)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate
HJMWRFQWUXHRAH-DWPQHFKNSA-N
CCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(CC(=O)[C@]3([C@H]2CCC4=CC(=O)C(=C[C@@]43C)Br)F)C)C)C(=O)CCl