(3-Chlorophenyl)(phenyl)methanol is a research compound consisting of a benzhydrol structure bearing a chlorine substituent on one aromatic ring. It is commonly used as a laboratory reagent in chemical and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 63012-03-3
1,7-DICHLORO-4-METHOXYISOQUINOLINE
research compound
(2E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid
research compound
4-Chloro-2-iodoaniline
research compound
Cyclopentylboronic acid
synthetic intermediate for organoboron chemistry
(3-chlorophenyl)-phenylmethanol
DDCJHFYXAPQYLA-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)O