This compound is a research compound featuring an aromatic ring with acid, ether, and halogen functional groups. It is primarily used as a laboratory reagent for chemical and pharmaceutical research studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 630424-79-2
3',4'-dimethoxycinnamic acid
research compound
4-Chloro-2-iodoaniline
research compound
Cyclopentylboronic acid
synthetic intermediate for organoboron chemistry
4-Fluoro-2-methylbenzaldehyde
research compound
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid
NVEDFCULNXTLOA-HWKANZROSA-N
COC1=C(C=CC(=C1)/C=C/C(=O)O)F
—