N-Boc-L-tert-Leucine is an amino acid derivative used as a building block in peptide synthesis. It features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly employed to shield the amino group during solid-phase or solution-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 62965-35-9
Fmoc-His(Boc)-OH
amino acid derivative for peptide synthesis
Methyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate
4-Pyridineethanethiol Hydrochloride
Pharmaceutical intermediate
Methyl 2,4-dichloropyrimidine-6-carboxylate
Pharmaceutical intermediate
Androstenedione
steroid hormone intermediate
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoic acid
Protected amino acid for peptide synthesis
(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-SSDOTTSWSA-N
CC(C)(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C