This compound is a protected amino acid derivative, specifically a tert-butoxycarbonyl (Boc)-protected form of D-tert-butylglycine. It is primarily used as a building block in peptide synthesis, where the protecting groups facilitate controlled formation of peptide bonds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 124655-17-0
3-methylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
(1S,4R)-4-(2-Amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-carboxylate
Impurity of abacavir synthesis
2-(4-ethylphenyl)-2-methylpropanoic acid
Pharmaceutical intermediate
5-(4'-(Bromomethyl)(1,1'-biphenyl)-2-yl)-1-trityl-1h-tetraazole
pharmaceutical intermediate
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-ZETCQYMHSA-N
CC(C)(C)[C@H](C(=O)O)NC(=O)OC(C)(C)C