3-Acetamidophthalic anhydride, also known as This compound, is a chemical compound used as a pharmaceutical intermediate in drug manufacturing. It features an amide group and a fused aromatic ring system with ester functionalities, contributing to its role in synthetic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6296-53-3
Butanedioic acid, 2,3-dihydroxy-, bis(1-methylethyl) ester, (2S,3S)-
chiral building block for synthesis
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
Methyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate
4-Pyridineethanethiol Hydrochloride
Pharmaceutical intermediate
Tetrabromophthalic anhydride
reactive flame retardant
3-Chlorophthalic anhydride
Pharmaceutical intermediate for synthesis
Trimellitic anhydride chloride
Pharmaceutical intermediate
3-Iodophthalic anhydride
research compound
N-(1,3-dioxo-2-benzofuran-4-yl)acetamide
PAUAJOABXCGLCN-UHFFFAOYSA-N
CC(=O)NC1=CC=CC2=C1C(=O)OC2=O