3-Nitrophthalic acid is a research reagent used primarily in crystallographic studies. It is characterized by the formation of O—H···O and C—H···O hydrogen bond motifs, which generate sheet-like structures in the solid state.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 603-11-2
2-Acetyl-6-nitrobenzoic acid
Pharmaceutical intermediate
Methyl 2,3-dichloroisonicotinate
research compound
2-Chloro-5-methyl-4-nitropyridine N-oxide
research compound
Alpha-Naphthoflavone
research compound
Methyl 1-amino-1-cyclopentanecarboxylate, HCl
research compound for peptide synthesis
3-nitrophthalic acid
KFIRODWJCYBBHY-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(=O)O