2-Acetyl-6-nitrobenzoic acid is a chemical compound featuring a benzene ring substituted with an acetyl group, a nitro group, and a carboxylic acid group. It is primarily used as a pharmaceutical intermediate in the manufacturing of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13619-70-0
3-Nitrophthalic acid
crystallographic research reagent
Ethyl 2-{[(2'-cyano[1,1'-biphenyl]-4-yl)methyl]amino}-3-nitrobenzoate
pharmaceutical intermediate
Ethyl 3-amino-2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)benzoate
Pharmaceutical intermediate
2-((tert-Butoxycarbonyl)amino)-4-chlorobenzoic acid
Boc-protected amino acid intermediate
6-methoxypyrazine-2-carbonitrile
Pharmaceutical intermediate for synthesis
2-acetyl-6-nitrobenzoic acid
VWPOICRZRFJFMA-UHFFFAOYSA-N
CC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)O