Dithizone, also known as (Phenylazo)thioformic acid 2-phenylhydrazide, is a member of phenylhydrazines. It is commonly employed as an analytical reagent for the detection of metals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 60-10-6
Thiodiglycolic acid
analytical reagent for metal detection
Phloretin
research compound
Cyclic AMP
research reagent
Glycine hydrochloride
Buffer and reagent in organic chemistry
Methyl 3-chloropropanoate
research compound
1-anilino-3-phenyliminothiourea
UOFGSWVZMUXXIY-UHFFFAOYSA-N
C1=CC=C(C=C1)NNC(=S)N=NC2=CC=CC=C2