3',5'-cyclic AMP is a 3',5'-cyclic purine nucleotide with adenine as the nucleobase. It functions as a metabolite in mice, Escherichia coli, and humans.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 60-92-4
Rp-cAMPS triethylammonium salt
research compound
Glycine hydrochloride
Buffer and reagent in organic chemistry
Methyl 3-chloropropanoate
research compound
Tert-Butyldiphenylphosphine
ligand for homogeneous catalysis
Di-tert-butylmethylphosphine
phosphine ligand for catalysis
8-Bromo-cAMP sodium salt
research compound
Bucladesine Calcium
research compound
Bucladesine sodium
phosphodiesterase inhibitor research tool
(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol
IVOMOUWHDPKRLL-KQYNXXCUSA-N
C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O