Ethyl 3-amino-2-methylbenzoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an amine and an ester functional group, making it suitable for further synthetic transformations in drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 57414-85-4
Benzyl Dimethylphosphonoacetate
Pharmaceutical intermediate
(3-Iodophenyl)methanol
Pharmaceutical intermediate for organic synthesis
4-Chloro-2-methoxybenzoic acid
pharmaceutical intermediate
Methyl (2-chlorophenyl)acetate
Pharmaceutical intermediate for drug synthesis
ethyl 3-amino-2-methylbenzoate
RZDRJEHTKWQFQO-UHFFFAOYSA-N
CCOC(=O)C1=C(C(=CC=C1)N)C