4-Chloro-2-methoxybenzoic acid is a chemical compound used primarily as a pharmaceutical intermediate. It is a structural building block in the synthesis of various active pharmaceutical ingredients, including the investigational aurora A kinase inhibitor alisertib.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 57479-70-6
5-Chloro-2-methoxybenzoic acid
Pharmaceutical intermediate for drug synthesis
Methyl (2-chlorophenyl)acetate
Pharmaceutical intermediate for drug synthesis
2,4,5-Trichloropyrimidine
pharmaceutical synthesis intermediate
4-CHLORO-5-NITRO-1H-IMIDAZOLE
pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-N-methyl-2-aminoethanol
Boc-protected amino alcohol intermediate
4-chloro-2-methoxybenzoic acid
UFEYMXHWIHFRBX-UHFFFAOYSA-N
COC1=C(C=CC(=C1)Cl)C(=O)O