1H-Imidazole-4,5-dicarboxylic acid is a chemical compound used as a research reagent, particularly for the synthesis and study of imidazole derivatives. Its structure features an imidazole ring with two carboxylic acid groups, giving it moderate polarity and hydrogen-bonding capacity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 570-22-9
N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine
TAAR1 agonist research compound
Ethyl 1-(3-chloro-5-((4-(4-chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)thiazol-2-yl)carbamoyl)pyridin-2-yl)piperidine-4-carboxylate
research compound
Dichlorodehydroabietic acid
Reference standard for abietic acid impurity
4-Maleimidobutyric acid
Crosslinking reagent for bioconjugation
1H-imidazole-4,5-dicarboxylic acid
ZEVWQFWTGHFIDH-UHFFFAOYSA-N
C1=NC(=C(N1)C(=O)O)C(=O)O