4-Maleimidobutyric acid is a compound containing a maleimide group and a carboxylic acid, used as a crosslinking reagent in bioconjugation research. It is characterized by its ability to form stable thioether bonds with thiol groups, making it valuable for modifying proteins and other biomolecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 57078-98-5
11-Maleimidoundecanoic acid
n.a
7-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid
research compound
6-Maleimidocaproic acid
Research reagent for bioconjugation
3-Maleimidopropionic acid
pharmaceutical intermediate for bioconjugation
2,5-Dioxopyrrolidin-1-yl 3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoate
Crosslinking reagent for bioconjugation
(S)-(-)-3-CYCLOHEXENE-1-CARBOXYLIC ACID
research compound
1H-Imidazole-4-carbonitrile
research compound
4-bromonaphthalen-1-ol
research compound
4-(2,5-dioxopyrrol-1-yl)butanoic acid
NCPQROHLJFARLL-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCCC(=O)O