9,10,16-Trihydroxyhexadecanoic acid, also known as aleuritic acid, is a naturally occurring hydroxy fatty acid that is a key component of lac resin produced by the insect Kerria lacca. It serves as a starting material in the synthesis of fragrance compounds and other specialty chemicals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 533-87-9
9,10,16-trihydroxyhexadecanoic acid
MEHUJCGAYMDLEL-UHFFFAOYSA-N
C(CCCC(C(CCCCCCO)O)O)CCCC(=O)O