This compound is a protected amino acid derivative, specifically the tert-butoxycarbonyl (Boc) protected form of D-tryptophan. It is primarily used as a building block in the synthesis of peptides and other pharmaceutical intermediates.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5241-64-5
Tert-butyl (R)-(1-(1H-indol-3-yl)propan-2-yl)carbamate
research compound
Tert-Butyl ((2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl)carbamate
Pharmaceutical intermediate for peptide synthesis
Boc-Trp(Boc)-OH
Protected amino acid building block
Z-THR(TBU)-OME
Protected amino acid building block
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
2-(naphthalen-1-yl)propanal
Pharmaceutical intermediate or impurity reference
Tetrahydrofuran-2-carbonyl chloride
Pharmaceutical intermediate for synthesis
(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
NFVNYBJCJGKVQK-CYBMUJFWSA-N
CC(C)(C)OC(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)O