Z-THR(TBU)-OME (This compound) is a protected amino acid derivative commonly used as a building block in peptide synthesis. It features a benzyloxycarbonyl (Cbz) amino protecting group and a tert-butyl ether side-chain protection on the threonine residue, making it suitable for stepwise solid-phase or solution-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52785-41-8
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
Boc-Trp(Boc)-OH
Protected amino acid building block
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
Boc-lysine
Protected amino acid building block
Methyl (4-cyanophenyl)acetate
Pharmaceutical intermediate for API synthesis
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate
protected amino acid intermediate
6-(Bromomethyl)-2-imino-2,3-dihydropteridin-4-amine--hydrogen bromide (1/1)
Pharmaceutical intermediate synthesis
Telmisartan methyl ester
pharmaceutical intermediate
methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate
NKWFWFWEJCKORD-OCCSQVGLSA-N
C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)OC(C)(C)C