t-Boc-aminocaproic-N-hydroxysuccinimide is a chemical compound used as a protected amino acid derivative in peptide synthesis. Its structure includes a tert-butoxycarbonyl (Boc) protecting group and an N-hydroxysuccinimide ester, making it suitable for coupling reactions in laboratory and industrial peptide manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 51513-80-5
1-tert-Butyl 18-(2,5-dioxopyrrolidin-1-yl) octadecanedioate
research compound
1-tert-Butyl 20-(2,5-dioxopyrrolidin-1-yl) icosanedioate
research compound for PEGylation
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Boc-D-alanine
protected amino acid for peptide synthesis
Boc-l-lys(ivdde)-oh
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
(2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate
TYJPSIQEEXOQLC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O