Methyl O-tert-butyl-L-tyrosinate hydrochloride is a protected derivative of the amino acid tyrosine, commonly used in peptide synthesis. It features a tert-butyl ether protecting group on the phenolic oxygen and a methyl ester on the carboxyl group, supplied as a hydrochloride salt.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 51482-39-4
O-tert-Butyl-L-tyrosine
pharmaceutical intermediate for peptide synthesis
4-Hydroxy-3-pyridinesulfonic acid
Pharmaceutical intermediate for API synthesis
T-Boc-aminocaproic-N-hydroxysuccinimide
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride
PAFVAMWJVIIMQK-YDALLXLXSA-N
CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC)N.Cl