5-Acetamido-2-aminobenzoic acid is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an amino group and a carboxylic acid group, and is commonly employed in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 50670-83-2
L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(phenylmethyl)-
Protected amino acid for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
5-acetamido-2-aminobenzoic acid
GSOHXJQXAKNJES-UHFFFAOYSA-N
CC(=O)NC1=CC(=C(C=C1)N)C(=O)O