This compound is a protected amino acid derivative used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a benzyl group on the cysteine side chain, making it suitable for solid-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5068-28-0
N-alpha-t-Butyloxycarbonyl-S-(4-methyl-benzyl)-L-cysteine
research reagent for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
Methyl 3-methoxy-4-nitrobenzoate
pharmaceutical intermediate
(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
IFVORPLRHYROAA-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O