4-Chloromandelic acid is a chemical compound featuring a chlorophenyl group and a hydroxyacetic acid moiety. It serves as a pharmaceutical intermediate used in the synthesis of various active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 492-86-4
Phenyl N-phenylcarbamate
Pharmaceutical intermediate
1-Adamantaneacetic acid
pharmaceutical intermediate
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
Hippuric acid
Pharmaceutical intermediate for synthesis
2-(4-chlorophenyl)-2-hydroxyacetic acid
BWSFWXSSALIZAU-UHFFFAOYSA-N
C1=CC(=CC=C1C(C(=O)O)O)Cl