Phenyl N-phenylcarbamate is a chemical compound characterized by its two aromatic rings and an ether linkage, with a molecular weight of 213. 08 and a logP of 3.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4930-03-4
1-Adamantaneacetic acid
pharmaceutical intermediate
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
Hippuric acid
Pharmaceutical intermediate for synthesis
Methyl 1-t-butoxycarbonyl-4-trifluoromethylpiperidine-4-carboxylate
pharmaceutical intermediate
phenyl N-phenylcarbamate
XVNKRRXASPPECQ-UHFFFAOYSA-N
C1=CC=C(C=C1)NC(=O)OC2=CC=CC=C2