4-(Trifluoromethyl)benzoic acid is an organic compound featuring a carboxylic acid group attached to a benzene ring that carries a trifluoromethyl substituent. It is commonly used as a research reagent in synthetic chemistry and materials science.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 455-24-3
3,5-Difluorobenzoic acid
Research reagent
4-Amino-3-fluorobenzoic acid
research compound
4-hydroxypyridine-d5
deuterated research reagent
LITHIUM-P-STYRENESULFONATE
Ion exchange monomer research
Sodium 4-(trifluoromethyl)benzoate
research compound
4-(trifluoromethyl)benzoic acid
SWKPKONEIZGROQ-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)C(F)(F)F