4-Hydroxypyridine-d5 is a deuterated research reagent where all five hydrogen atoms on the pyridine ring and hydroxyl group are replaced with deuterium. It is commonly used as an internal standard in analytical chemistry and metabolic studies due to its isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 45503-33-1
LITHIUM-P-STYRENESULFONATE
Ion exchange monomer research
4-(Aminomethyl)pyrimidine
research compound
Benzenediazonium, 3-chloro-, tetrafluoroborate(1-)
diazonium salt for synthesis
3-Fluorobenzyl alcohol
research compound
4-HYDROXYPYRIDINE
Chemical intermediate for synthesis
2,3,5,6-tetradeuterio-4-deuteriooxypyridine
GCNTZFIIOFTKIY-HXRFYODMSA-N
[2H]C1=C(N=C(C(=C1O[2H])[2H])[2H])[2H]