4-Aminopyridine-d6 is a deuterated form of 4-aminopyridine, where six hydrogen atoms are replaced by deuterium. It is primarily used as a research reagent in laboratory settings, particularly for studies involving isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 45498-20-2
4-Iodobenzotrifluoride
laboratory reagent and synthetic intermediate
4-(Trifluoromethyl)benzoic acid
research compound
3,5-Difluorobenzoic acid
Research reagent
4-Amino-3-fluorobenzoic acid
research compound
4-أمينو البيريدين
active pharmaceutical ingredient
N,N,2,3,5,6-hexadeuteriopyridin-4-amine
NUKYPUAOHBNCPY-UDDMDDBKSA-N
[2H]C1=C(N=C(C(=C1N([2H])[2H])[2H])[2H])[2H]