1,2-Dioleoyl-sn-Glycero-3-Phosphocholine is a phospholipid compound commonly used as a research reagent. It is a zwitterionic molecule with two oleic acid chains and is primarily studied for its role in membrane biology and lipid research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4235-95-4
SOPC
phospholipid biochemical research reagent
POPC
phospholipid for biophysical experiments
Lecithin (NF)
emulsifier in food and feed
L-Dilinoleoyllecithin
research compound
1,2-Dimyristoyl-sn-glycero-3-phosphate, sodium salt
phospholipid research reagent
1,2-Dimyristoyl-sn-glycero-3-phospho-L-serine sodium salt
phospholipid research reagent
1,2-Dilauroyl-sn-glycero-3-phosphocholine
phospholipid research reagent
Sodium 1,2-dioleoyl-sn-glycero-3-phospho-L-serine
phospholipid research reagent
[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate
SNKAWJBJQDLSFF-NVKMUCNASA-N
CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC