4-Bromo-2-fluoro-1,1'-biphenyl is a brominated and fluorinated biphenyl compound used as a pharmaceutical intermediate. It is primarily supplied for use in chemical synthesis and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 41604-19-7
Allopurinol Impurity 9
Allopurinol impurity reference standard
Beta-D-Galactose pentaacetate
Pharmaceutical intermediate for carbohydrate chemistry
(2,3,4,5,6-2H5)Aniline
Pharmaceutical intermediate
4-Piperidone
pharmaceutical intermediate
4-bromo-2-fluoro-1-phenylbenzene
HTRNHWBOBYFTQF-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)F