This compound is a deuterium-labeled aniline derivative, specifically the pentadeuterio form of aniline, where all five aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of isotopically labeled compounds for research and development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4165-61-1
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
2,4-Dichlorothiazole
Pharmaceutical intermediate
ANILINE
chemical intermediate for dyes and polymers
(2H7)Aniline
Deuterated research reagent
2,3,4,5,6-pentadeuterioaniline
PAYRUJLWNCNPSJ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N)[2H])[2H]