Dihydrofolic acid (DHF) is a derivative of folic acid (vitamin B9) that serves as a substrate in folate metabolism. It is converted to tetrahydrofolic acid by the enzyme dihydrofolate reductase, a step essential for the synthesis of purines and pyrimidines, the building blocks of DNA and RNA.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4033-27-6
(R)-alpha-Propargylalanine
research compound for peptide synthesis
3,4-DIMETHOXYBENZOPHENONE
research compound
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
10-Formyldihydrofolate
research compound for folate metabolism
(2S)-2-[[4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid
OZRNSSUDZOLUSN-LBPRGKRZSA-N
C1C(=NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O