3,4-Dimethoxybenzophenone is a research compound structurally defined as This compound. It features a benzophenone core with two methoxy substituents on one aromatic ring, contributing to its physicochemical properties such as moderate lipophilicity and low molecular weight.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4038-14-6
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
DICYCLOHEXYL(4-(N,N-DIMETHYLAMINO)PHENYL)PHOSPHINE
organophosphine ligand for catalysis
2,3-dihydro-1H-indene-4-carboxylic Acid
Research compound for organic synthesis
(3,4-dimethoxyphenyl)-phenylmethanone
WCNOATOQNSHEFK-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)OC