2-Chloro-3-nitrobenzoic acid is a chemical compound that serves as an intermediate in pharmaceutical manufacturing. It features a benzene ring substituted with a chlorine atom, a nitro group, and a carboxylic acid group, giving it moderate polarity and aromatic character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3970-35-2
2-Chloro-3-nitrotoluene
Pharmaceutical intermediate
4-METHYLPIPERIDIN-4-OL
pharmaceutical intermediate
(S)-2-benzylsuccinic acid
ACE inhibitor intermediate
1-Phenethyl-4-piperidone
Pharmaceutical intermediate for fentanyl synthesis
2-chloro-3-nitrobenzoic acid
JRQDVRIQJJPHEQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O