(S)-2-Benzylsuccinic acid is a chiral dicarboxylic acid used as an intermediate in the manufacture of ACE inhibitor pharmaceuticals. Its structure features a benzyl group and two carboxylic acid functions, contributing to its role in the synthesis of compounds that regulate blood pressure.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3972-36-9
1-Phenethyl-4-piperidone
Pharmaceutical intermediate for fentanyl synthesis
2-Hydroxy-6-methyl-3-nitropyridine
pharmaceutical intermediate
3-Amino-2-chloro-6-picoline
pharmaceutical intermediate
Corey Lactone Aldehyde Benzoate
Prostaglandin intermediate
(2S)-2-benzylbutanedioic acid
GTOFKXZQQDSVFH-VIFPVBQESA-N
C1=CC=C(C=C1)C[C@@H](CC(=O)O)C(=O)O