5-(Piperidin-4-yl)-1H-indole is a research compound featuring a piperidine ring attached to an indole core. Its structure includes an amine group and two aromatic rings, making it of interest for laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 383861-22-1
PC (brain, bovine)
research reagent for lipid studies
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
D-Pipercolic acid HCl
research compound
Cy-vBRIDP
phosphine ligand for homogeneous catalysis
5-piperidin-4-yl-1H-indole
ULMINHJMQWBDGD-UHFFFAOYSA-N
C1CNCCC1C2=CC3=C(C=C2)NC=C3