2-(Methoxycarbonyl)benzeneboronic acid is a boronic acid derivative used primarily as a research reagent in organic synthesis. It functions as a coupling partner in Suzuki cross-coupling reactions, enabling the formation of carbon-carbon bonds in complex molecular structures.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 374538-03-1
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
4-tert-Butoxyphenylboronic acid
Suzuki coupling reagent
Pyridine-2-boronic acid, pinacol ester
Suzuki coupling reagent
Nbi 31772
insulin-like growth factor binding protein inhibitor
2-chloro-3-fluoro-6-methylpyridine
research compound
6-Bromo-3-fluoro-2-methylpyridine
Pharmaceutical research compound
Kisspeptin-10 (human)
research peptide for GPR54 ligand studies
(2-methoxycarbonylphenyl)boronic acid
ODAXNYMENLFYMY-UHFFFAOYSA-N
B(C1=CC=CC=C1C(=O)OC)(O)O