Nbi 31772 is a research compound that functions as a potent inhibitor of insulin-like growth factor-binding protein (IGFBP). It is an isoquinoline derivative bearing multiple hydroxy and carboxy substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 374620-70-9
2-chloro-3-fluoro-6-methylpyridine
research compound
6-Bromo-3-fluoro-2-methylpyridine
Pharmaceutical research compound
Kisspeptin-10 (human)
research peptide for GPR54 ligand studies
P-Tolyl isocyanate
isocyanate reagent for synthesis
1-(3,4-dihydroxybenzoyl)-6,7-dihydroxyisoquinoline-3-carboxylic acid
ZCMFEWUYBFMLIN-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)C2=NC(=CC3=CC(=C(C=C32)O)O)C(=O)O)O)O