2-Phenylethyl methacrylate is an industrial chemical primarily used as a monomer for polymer synthesis. It features an aromatic ring and an ester functional group, contributing to its utility in creating specialized polymers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3683-12-3
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
1-ADAMANTYL METHACRYLATE
Monomer for polymer synthesis
Gamma-butyrolactone methacrylate
Monomer for polymer synthesis
Phenyl methacrylate
Monomer for polymer synthesis
Benzenamine, ar-nonyl-N-(nonylphenyl)-
Antioxidant and lubricating additive
[4,5'-Biisobenzofuran]-1,1',3,3'-tetrone
monomer for polyimide synthesis
1-(2-Hydroxyethyl)imidazolidin-2-one
monomer for polymer production
[2,3,4,5-tetrabromo-6-(hydroxymethyl)phenyl]methanol
Perbrominated aromatic alcohol intermediate
2-phenylethyl 2-methylprop-2-enoate
ILZXXGLGJZQLTR-UHFFFAOYSA-N
CC(=C)C(=O)OCCC1=CC=CC=C1