1-Adamantyl methacrylate is a monomer used in polymer synthesis. Its structure combines a rigid, strain-free adamantane cage with a methacrylate ester group, making it valuable for producing specialty polymers with enhanced thermal and mechanical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16887-36-8
3-[(2-METHYLPROP-2-ENOYL)OXY]ADAMANTAN-1-YL 2-METHYLPROP-2-ENOATE
polymer crosslinking monomer
3-Hydroxy-1-adamantyl methacrylate
Monomer for polymer synthesis
Gamma-butyrolactone methacrylate
Monomer for polymer synthesis
Phenyl methacrylate
Monomer for polymer synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
Sodium hexafluorosilicate
wood preservative, glass manufacturing, pesticides
Perfluorobutyl 1,3-dioxo-1H-benzo[de]isoquinoline-2(3H)-sulfonate
sulfonate ester reagent
Ammonium hexafluorosilicate
insecticide, miticide, wood preservative
1-adamantyl 2-methylprop-2-enoate
MZVABYGYVXBZDP-UHFFFAOYSA-N
CC(=C)C(=O)OC12CC3CC(C1)CC(C3)C2