2,4,6-Trimethylphenol-d11 is a deuterated analytical reference standard used primarily in research and analytical chemistry for quantitative analysis and method development. Its structure includes a phenolic ring with three trideuteriomethyl groups and deuterium atoms at specific positions, ensuring high isotopic purity for reliable tracing in mass spectrometry and other analytical techniques.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 362049-45-4
2,3,5-TRIMETHYLPHENOL-D11
Deuterated research reagent
Methyl Paraben-d4
deuterated internal standard for analysis
D-Phenylalanine-d5
deuterated amino acid research reagent
1,3-Dioxolan-2-one-d4
deuterated research compound
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)phenol
BPRYUXCVCCNUFE-JXCHDVSKSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]