(2-Bromoethyl)benzene-d5 is a deuterated research reagent used in chemical and pharmaceutical research. Its structure features a bromoethyl group attached to a pentadeuterated benzene ring, making it useful as an internal standard or labeled compound in analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35845-64-8
4-Bromo-2,8-bis(trifluoromethyl)quinoline
research compound
5-Bromo-6-chloropyridin-2-amine
research compound
4-Phenylbutyric Acid-d11
deuterated research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
(2-BROMOETHYL)BENZENE
pharmaceutical intermediate for beta-phenethyl derivatives
1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene
WMPPDTMATNBGJN-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CCBr)[2H])[2H]