4-Phenylbutyric Acid-d11 is a deuterated research compound, specifically a stable isotope-labeled analog of 4-phenylbutyric acid in which eleven hydrogen atoms are replaced by deuterium. Its primary significance lies in its use as a research reagent, enabling analytical and metabolic studies through isotope tracing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 358730-86-6
Diisobutyl Phthalate-d4
isotopically labeled research compound
4-Nonylphenol-D5
Deuterated analytical reference standard
Dicyclohexyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
2,6-DICHLOROTOLUENE-3,4,5-D3
Deuterated research compound
Sodium 4-phenylbutyrate
active pharmaceutical ingredient
4-PHENYLBUTYRIC ACID
Histone deacetylase inhibitor
2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid
OBKXEAXTFZPCHS-VRWITDQQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H]