2-Fluoro-3-methoxyphenylboronic acid is a boronic acid derivative used as a pharmaceutical intermediate. It is primarily supplied for use in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 352303-67-4
(2-amino-1,3-benzothiazol-6-yl)acetonitrile
Pharmaceutical intermediate synthesis
3-(4-chlorophenyl)pentanedioic acid
Pharmaceutical intermediate
1,1,1-Trifluoro-2-iodoethane
pharmaceutical intermediate
4-(2-Aminoethyl)benzenesulfonamide
Pharmaceutical intermediate for API synthesis
(2-fluoro-3-methoxyphenyl)boronic acid
JCKZNMSBFBPDPM-UHFFFAOYSA-N
B(C1=C(C(=CC=C1)OC)F)(O)O