3-(4-chlorophenyl)pentanedioic acid is a chemical compound used as a pharmaceutical intermediate. It contains a chlorinated aromatic ring and two carboxylic acid groups, making it a building block in the synthesis of various medicinal agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35271-74-0
(S)-Baclofen
active pharmaceutical ingredient
(R)-Baclofen
active pharmaceutical ingredient
Baclofen
active pharmaceutical ingredient
1,1,1-Trifluoro-2-iodoethane
pharmaceutical intermediate
4-(2-Aminoethyl)benzenesulfonamide
Pharmaceutical intermediate for API synthesis
4-Aminopyridine 1-oxide
pharmaceutical intermediate
2-(3-Oxobutanamido)benzoic acid
Pharmaceutical intermediate for peptide synthesis
3-(4-chlorophenyl)pentanedioic acid
URXVLIVRJJNJII-UHFFFAOYSA-N
C1=CC(=CC=C1C(CC(=O)O)CC(=O)O)Cl