H-His(Trt)-OH, or N-trityl-L-histidine, is a protected amino acid derivative commonly used as a pharmaceutical intermediate. Its structure incorporates a trityl (triphenylmethyl) protecting group on the imidazole nitrogen of histidine, making it a versatile building block in peptide synthesis and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35146-32-8
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
3-Amino-N-((phenylmethoxy)carbonyl)-D-alanine
protected amino acid intermediate
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
N-Carbobenzoxy-L-glutamine
protected amino acid intermediate
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
2'-Hydroxy-3-phenylpropiophenone
Lisdexamfetamine intermediate
N-Ethyl-4-hydroxypiperidine
pharmaceutical intermediate
1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate
chiral reagent for resolution
(2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid
BSZQZNOAYQCQFZ-QHCPKHFHSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)N