1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate is a chiral compound used as a resolving agent in the separation of enantiomers. Its significance lies in its role as a chiral reagent for resolution in chemical synthesis and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35193-64-7
4-Fluorobenzyl chloride
Pharmaceutical intermediate
2,2,2-TRIFLUOROETHYL METHACRYLATE
Pharmaceutical intermediate
1-boc-piperidin-3-yl-propionic acid
Pharmaceutical intermediate for peptide synthesis
3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carbonitrile
Pharmaceutical intermediate for synthesis
(R)-(-)-1,1'-Binaphthalene-2,2'-diyl hydrogen phosphate
chiral auxiliary for asymmetric synthesis
13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide
JEHUZVBIUCAMRZ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=CC3=C2C4=C(C=CC5=CC=CC=C54)OP(=O)(O3)O