This compound is a research reagent used in organic synthesis. Its crystal structure has been characterized, confirming the arrangement of its functional groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 34387-89-8
2-Chloro-6-methoxypyridin-3-amine
research compound
Trisodium cytidine 5'-diphosphate
nucleoside diphosphate research reagent
2,5-Dioxopyrrolidin-1-yl 4-(vinylsulfonyl)benzoate
bioconjugation reagent
1-Bromo-2,3,4,5,6-pentafluorobenzene
research compound
tert-butyl N-(1,3-dioxoisoindol-2-yl)carbamate
IOPZBVFVFPPDSC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NN1C(=O)C2=CC=CC=C2C1=O