1-Bromo-2,3,4,5,6-pentafluorobenzene is a brominated, fully fluorinated aromatic compound used primarily as a research reagent. Its structure consists of a benzene ring with one bromine atom and five fluorine atoms, giving it distinct chemical properties for laboratory applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 344-04-7
1-bromo-2,3,4,5,6-pentafluorobenzene
XEKTVXADUPBFOA-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)Br)F)F)F