7-methyl-L-tryptophan is a research compound. It is a derivative of the amino acid L-tryptophan, characterized by the presence of a methyl group at the 7-position of the indole ring.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 33468-36-9
4-chloro-6-methoxy-2-methyl-3-propylquinoline
research compound
Di-tert-butyl hydrogen phosphate; potassium salt
Phosphate ester salt reagent
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
(2S)-2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid
KBOZNJNHBBROHM-JTQLQIEISA-N
CC1=C2C(=CC=C1)C(=CN2)C[C@@H](C(=O)O)N